<!–名称： Ethyl lactate
–>
| Product name | Ethyl lactate |
| CAS RN | 687-47-8 |
| Assay | 99% |
| Alias | Lactic acid ethyl ester; Propanoic acid, 2-hydroxy-, ethyl ester; ethyl 2-hydroxypropanoate; ethyl (2R)-2-hydroxypropanoate; Dl-Ethyl Lactate |
| EINECS No. | 211-694-1 |
| Molecular formula | C5H10O3 |
| Molecular weight | 118.1311 |
| InChI | InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3 |
| Density | 1.05g/cm3 |
| Melting point | -26℃ |
| Boiling point | 154.5°C at 760 mmHg |
| Flash point | 54.6°C |
| Solubility | SOLUBLE |
| Properties | Colorless transparent liquid, with strong liquor odor. |
| Melting point | -25℃ |
| Boiling point | 154.2℃ |
| Relative density | 1.0302 |
| Refractive index | 1.4124 |
| Flash point | 96℃ |
| Solubility | Easily soluble in ethyl alcohol and diethyl ether, soluble in water. |